C36H25AlN2O3S — CID 140803108
bis[(2-methylquinolin-8-yl)oxy]-naphtho[1,2-b][1]benzothiol-10-yloxyalumane (PubChem CID 140803108) has the molecular formula C36H25AlN2O3S and a molecular weight of 592.66 g/mol. Its IUPAC name is bis[(2-methylquinolin-8-yl)oxy]-naphtho[1,2-b][1]benzothiol-10-yloxyalumane.
| Compound Name | bis[(2-methylquinolin-8-yl)oxy]-naphtho[1,2-b][1]benzothiol-10-yloxyalumane |
|---|---|
| PubChem CID | 140803108 |
| Molecular Formula | C36H25AlN2O3S |
| Molecular Weight | 592.66 g/mol |
| Exact Mass | 592.14 |
| IUPAC Name | bis[(2-methylquinolin-8-yl)oxy]-naphtho[1,2-b][1]benzothiol-10-yloxyalumane |
| SMILES | Cc1ccc2cccc(O[Al](Oc3cccc4ccc(C)nc34)Oc3cccc4c3sc3c5ccccc5ccc43)c2n1 |
| InChI | InChI=1S/C16H10OS.2C10H9NO.Al/c17-14-7-3-6-12-13-9-8-10-4-1-2-5-11(10)15(13)18-16(12)14;2*1-7-5-6-8-3-2-4-9(12)10(8)11-7;/h1-9,17H;2*2-6,12H,1H3;/q;;;+3/p-3 |
| InChIKey | DCZYSWQLKDAORU-UHFFFAOYSA-K |
| XLogP | 9.44 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.66 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |