C41H47F2N3 — CID 140803240
1-[3,5-bis(4-hexylphenyl)phenyl]-3-(2,4-difluorophenyl)-5-propyl-1,2,4-triazole (PubChem CID 140803240) has the molecular formula C41H47F2N3 and a molecular weight of 619.84 g/mol. Its IUPAC name is 1-[3,5-bis(4-hexylphenyl)phenyl]-3-(2,4-difluorophenyl)-5-propyl-1,2,4-triazole.
| Compound Name | 1-[3,5-bis(4-hexylphenyl)phenyl]-3-(2,4-difluorophenyl)-5-propyl-1,2,4-triazole |
|---|---|
| PubChem CID | 140803240 |
| Molecular Formula | C41H47F2N3 |
| Molecular Weight | 619.84 g/mol |
| Exact Mass | 619.37 |
| IUPAC Name | 1-[3,5-bis(4-hexylphenyl)phenyl]-3-(2,4-difluorophenyl)-5-propyl-1,2,4-triazole |
| SMILES | CCCCCCc1ccc(-c2cc(-c3ccc(CCCCCC)cc3)cc(-n3nc(-c4ccc(F)cc4F)nc3CCC)c2)cc1 |
| InChI | InChI=1S/C41H47F2N3/c1-4-7-9-11-14-30-16-20-32(21-17-30)34-26-35(33-22-18-31(19-23-33)15-12-10-8-5-2)28-37(27-34)46-40(13-6-3)44-41(45-46)38-25-24-36(42)29-39(38)43/h16-29H,4-15H2,1-3H3 |
| InChIKey | RAXFJCLXSQSKTQ-UHFFFAOYSA-N |
| XLogP | 11.74 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.84 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|