C43H40N2 — CID 140803300
3-(4-tert-butylphenyl)-9-[2-(4-tert-butylphenyl)-4-pyridinyl]-6-phenylcarbazole (PubChem CID 140803300) has the molecular formula C43H40N2 and a molecular weight of 584.81 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-9-[2-(4-tert-butylphenyl)-4-pyridinyl]-6-phenylcarbazole.
| Compound Name | 3-(4-tert-butylphenyl)-9-[2-(4-tert-butylphenyl)-4-pyridinyl]-6-phenylcarbazole |
|---|---|
| PubChem CID | 140803300 |
| Molecular Formula | C43H40N2 |
| Molecular Weight | 584.81 g/mol |
| Exact Mass | 584.32 |
| IUPAC Name | 3-(4-tert-butylphenyl)-9-[2-(4-tert-butylphenyl)-4-pyridinyl]-6-phenylcarbazole |
| SMILES | CC(C)(C)c1ccc(-c2ccc3c(c2)c2cc(-c4ccccc4)ccc2n3-c2ccnc(-c3ccc(C(C)(C)C)cc3)c2)cc1 |
| InChI | InChI=1S/C43H40N2/c1-42(2,3)34-18-12-30(13-19-34)33-17-23-41-38(27-33)37-26-32(29-10-8-7-9-11-29)16-22-40(37)45(41)36-24-25-44-39(28-36)31-14-20-35(21-15-31)43(4,5)6/h7-28H,1-6H3 |
| InChIKey | TZLJDZQVGQRQDH-UHFFFAOYSA-N |
| XLogP | 11.77 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.81 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |