C19H26N6O6 — CID 140804142
tert-butyl N-[(3R)-1-(2-morpholin-4-yl-6-nitro-[1,3]oxazolo[4,5-b]pyridin-5-yl)pyrrolidin-3-yl]carbamate (PubChem CID 140804142) has the molecular formula C19H26N6O6 and a molecular weight of 434.45 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-(2-morpholin-4-yl-6-nitro-[1,3]oxazolo[4,5-b]pyridin-5-yl)pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-(2-morpholin-4-yl-6-nitro-[1,3]oxazolo[4,5-b]pyridin-5-yl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 140804142 |
| Molecular Formula | C19H26N6O6 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | tert-butyl N-[(3R)-1-(2-morpholin-4-yl-6-nitro-[1,3]oxazolo[4,5-b]pyridin-5-yl)pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCN(c2nc3nc(N4CCOCC4)oc3cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C19H26N6O6/c1-19(2,3)31-18(26)20-12-4-5-24(11-12)16-13(25(27)28)10-14-15(21-16)22-17(30-14)23-6-8-29-9-7-23/h10,12H,4-9,11H2,1-3H3,(H,20,26)/t12-/m1/s1 |
| InChIKey | LFKGMSDDRIGDJY-GFCCVEGCSA-N |
| XLogP | 2.07 |
| TPSA | 136.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|