C45H35N3Si — CID 140805258
2-[2-(11,11-dimethylindeno[1,2-b]carbazol-5-yl)phenyl]-9,9-dimethyl-4-phenyl-[1]benzosilolo[2,3-d]pyrimidine (PubChem CID 140805258) has the molecular formula C45H35N3Si and a molecular weight of 645.88 g/mol. Its IUPAC name is 2-[2-(11,11-dimethylindeno[1,2-b]carbazol-5-yl)phenyl]-9,9-dimethyl-4-phenyl-[1]benzosilolo[2,3-d]pyrimidine.
| Compound Name | 2-[2-(11,11-dimethylindeno[1,2-b]carbazol-5-yl)phenyl]-9,9-dimethyl-4-phenyl-[1]benzosilolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 140805258 |
| Molecular Formula | C45H35N3Si |
| Molecular Weight | 645.88 g/mol |
| Exact Mass | 645.26 |
| IUPAC Name | 2-[2-(11,11-dimethylindeno[1,2-b]carbazol-5-yl)phenyl]-9,9-dimethyl-4-phenyl-[1]benzosilolo[2,3-d]pyrimidine |
| SMILES | CC1(C)c2ccccc2-c2cc3c(cc21)c1ccccc1n3-c1ccccc1-c1nc(-c2ccccc2)c2c(n1)[Si](C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C45H35N3Si/c1-45(2)35-22-12-8-18-29(35)33-27-39-34(26-36(33)45)30-19-9-13-23-37(30)48(39)38-24-14-10-20-31(38)43-46-42(28-16-6-5-7-17-28)41-32-21-11-15-25-40(32)49(3,4)44(41)47-43/h5-27H,1-4H3 |
| InChIKey | UXQYMHRVGFKNMM-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.88 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|