C36H27N3Si — CID 154010624
2-(4-carbazol-9-ylphenyl)-9,9-dimethyl-4-phenyl-[1]benzosilolo[2,3-d]pyrimidine (PubChem CID 154010624) has the molecular formula C36H27N3Si and a molecular weight of 529.72 g/mol. Its IUPAC name is 2-(4-carbazol-9-ylphenyl)-9,9-dimethyl-4-phenyl-[1]benzosilolo[2,3-d]pyrimidine.
| Compound Name | 2-(4-carbazol-9-ylphenyl)-9,9-dimethyl-4-phenyl-[1]benzosilolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 154010624 |
| Molecular Formula | C36H27N3Si |
| Molecular Weight | 529.72 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | 2-(4-carbazol-9-ylphenyl)-9,9-dimethyl-4-phenyl-[1]benzosilolo[2,3-d]pyrimidine |
| SMILES | C[Si]1(C)c2ccccc2-c2c(-c3ccccc3)nc(-c3ccc(-n4c5ccccc5c5ccccc54)cc3)nc21 |
| InChI | InChI=1S/C36H27N3Si/c1-40(2)32-19-11-8-16-29(32)33-34(24-12-4-3-5-13-24)37-35(38-36(33)40)25-20-22-26(23-21-25)39-30-17-9-6-14-27(30)28-15-7-10-18-31(28)39/h3-23H,1-2H3 |
| InChIKey | DARVADJOPUVLLF-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.72 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|