C46H33N3Si — CID 154010674
9,9-dimethyl-4-phenyl-2-[3-(7-phenylbenzo[c]carbazol-10-yl)phenyl]-[1]benzosilolo[2,3-d]pyrimidine (PubChem CID 154010674) has the molecular formula C46H33N3Si and a molecular weight of 655.88 g/mol. Its IUPAC name is 9,9-dimethyl-4-phenyl-2-[3-(7-phenylbenzo[c]carbazol-10-yl)phenyl]-[1]benzosilolo[2,3-d]pyrimidine.
| Compound Name | 9,9-dimethyl-4-phenyl-2-[3-(7-phenylbenzo[c]carbazol-10-yl)phenyl]-[1]benzosilolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 154010674 |
| Molecular Formula | C46H33N3Si |
| Molecular Weight | 655.88 g/mol |
| Exact Mass | 655.24 |
| IUPAC Name | 9,9-dimethyl-4-phenyl-2-[3-(7-phenylbenzo[c]carbazol-10-yl)phenyl]-[1]benzosilolo[2,3-d]pyrimidine |
| SMILES | C[Si]1(C)c2ccccc2-c2c(-c3ccccc3)nc(-c3cccc(-c4ccc5c(c4)c4c6ccccc6ccc4n5-c4ccccc4)c3)nc21 |
| InChI | InChI=1S/C46H33N3Si/c1-50(2)41-23-12-11-22-37(41)43-44(31-15-5-3-6-16-31)47-45(48-46(43)50)34-18-13-17-32(28-34)33-25-26-39-38(29-33)42-36-21-10-9-14-30(36)24-27-40(42)49(39)35-19-7-4-8-20-35/h3-29H,1-2H3 |
| InChIKey | GSPKNIRBUXRMEV-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.88 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|