C42H29N3SSi — CID 140805819
14-[3-(5,5-dimethyl-2-phenyl-[1]benzosilolo[3,2-d]pyrimidin-4-yl)phenyl]-9-thia-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene (PubChem CID 140805819) has the molecular formula C42H29N3SSi and a molecular weight of 635.87 g/mol. Its IUPAC name is 14-[3-(5,5-dimethyl-2-phenyl-[1]benzosilolo[3,2-d]pyrimidin-4-yl)phenyl]-9-thia-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene.
| Compound Name | 14-[3-(5,5-dimethyl-2-phenyl-[1]benzosilolo[3,2-d]pyrimidin-4-yl)phenyl]-9-thia-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene |
|---|---|
| PubChem CID | 140805819 |
| Molecular Formula | C42H29N3SSi |
| Molecular Weight | 635.87 g/mol |
| Exact Mass | 635.19 |
| IUPAC Name | 14-[3-(5,5-dimethyl-2-phenyl-[1]benzosilolo[3,2-d]pyrimidin-4-yl)phenyl]-9-thia-14-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15,17,19-nonaene |
| SMILES | C[Si]1(C)c2ccccc2-c2nc(-c3ccccc3)nc(-c3cccc(-n4c5ccccc5c5c6c(ccc54)sc4ccccc46)c3)c21 |
| InChI | InChI=1S/C42H29N3SSi/c1-47(2)36-22-11-8-19-31(36)40-41(47)39(43-42(44-40)26-13-4-3-5-14-26)27-15-12-16-28(25-27)45-32-20-9-6-17-29(32)37-33(45)23-24-35-38(37)30-18-7-10-21-34(30)46-35/h3-25H,1-2H3 |
| InChIKey | AWVQBQSREXFVEQ-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.87 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|