C42H29N3SSi — CID 164730307
7-(5,5-dimethyl-2,4-diphenyl-[1]benzosilolo[3,2-d]pyrimidin-7-yl)-[1]benzothiolo[2,3-b]carbazole (PubChem CID 164730307) has the molecular formula C42H29N3SSi and a molecular weight of 635.87 g/mol. Its IUPAC name is 7-(5,5-dimethyl-2,4-diphenyl-[1]benzosilolo[3,2-d]pyrimidin-7-yl)-[1]benzothiolo[2,3-b]carbazole.
| Compound Name | 7-(5,5-dimethyl-2,4-diphenyl-[1]benzosilolo[3,2-d]pyrimidin-7-yl)-[1]benzothiolo[2,3-b]carbazole |
|---|---|
| PubChem CID | 164730307 |
| Molecular Formula | C42H29N3SSi |
| Molecular Weight | 635.87 g/mol |
| Exact Mass | 635.19 |
| IUPAC Name | 7-(5,5-dimethyl-2,4-diphenyl-[1]benzosilolo[3,2-d]pyrimidin-7-yl)-[1]benzothiolo[2,3-b]carbazole |
| SMILES | C[Si]1(C)c2cc(-n3c4ccccc4c4cc5c(cc43)sc3ccccc35)ccc2-c2nc(-c3ccccc3)nc(-c3ccccc3)c21 |
| InChI | InChI=1S/C42H29N3SSi/c1-47(2)38-23-28(45-34-19-11-9-17-29(34)32-24-33-30-18-10-12-20-36(30)46-37(33)25-35(32)45)21-22-31(38)40-41(47)39(26-13-5-3-6-14-26)43-42(44-40)27-15-7-4-8-16-27/h3-25H,1-2H3 |
| InChIKey | ZJZLEAYVYHGORY-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.87 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|