C22H15F3N4O5 — CID 140806579
2-[[10-hydroxy-7-isocyano-12-oxo-2-[4-(trifluoromethyl)phenyl]-1,4-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraene-11-carbonyl]amino]acetic acid (PubChem CID 140806579) has the molecular formula C22H15F3N4O5 and a molecular weight of 472.38 g/mol. Its IUPAC name is 2-[[10-hydroxy-7-isocyano-12-oxo-2-[4-(trifluoromethyl)phenyl]-1,4-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraene-11-carbonyl]amino]acetic acid.
| Compound Name | 2-[[10-hydroxy-7-isocyano-12-oxo-2-[4-(trifluoromethyl)phenyl]-1,4-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraene-11-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 140806579 |
| Molecular Formula | C22H15F3N4O5 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | 2-[[10-hydroxy-7-isocyano-12-oxo-2-[4-(trifluoromethyl)phenyl]-1,4-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraene-11-carbonyl]amino]acetic acid |
| SMILES | [C-]#[N+]c1cc2c3c(c1)c(O)c(C(=O)NCC(=O)O)c(=O)n3C(c1ccc(C(F)(F)F)cc1)CN2 |
| InChI | InChI=1S/C22H15F3N4O5/c1-26-12-6-13-18-14(7-12)27-8-15(10-2-4-11(5-3-10)22(23,24)25)29(18)21(34)17(19(13)32)20(33)28-9-16(30)31/h2-7,15,27,32H,8-9H2,(H,28,33)(H,30,31) |
| InChIKey | GWFKGYQDMQARRY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 125.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|