C22H16F3N3O4 — CID 140806600
ethyl 10-hydroxy-7-isocyano-12-oxo-3-[4-(trifluoromethyl)phenyl]-1,4-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraene-11-carboxylate (PubChem CID 140806600) has the molecular formula C22H16F3N3O4 and a molecular weight of 443.38 g/mol. Its IUPAC name is ethyl 10-hydroxy-7-isocyano-12-oxo-3-[4-(trifluoromethyl)phenyl]-1,4-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraene-11-carboxylate.
| Compound Name | ethyl 10-hydroxy-7-isocyano-12-oxo-3-[4-(trifluoromethyl)phenyl]-1,4-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 140806600 |
| Molecular Formula | C22H16F3N3O4 |
| Molecular Weight | 443.38 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | ethyl 10-hydroxy-7-isocyano-12-oxo-3-[4-(trifluoromethyl)phenyl]-1,4-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13),10-tetraene-11-carboxylate |
| SMILES | [C-]#[N+]c1cc2c3c(c1)c(O)c(C(=O)OCC)c(=O)n3CC(c1ccc(C(F)(F)F)cc1)N2 |
| InChI | InChI=1S/C22H16F3N3O4/c1-3-32-21(31)17-19(29)14-8-13(26-2)9-15-18(14)28(20(17)30)10-16(27-15)11-4-6-12(7-5-11)22(23,24)25/h4-9,16,27,29H,3,10H2,1H3 |
| InChIKey | FCRNPAFGBHEERI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 84.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.38 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|