C23H21BF2N2OS — CID 140807830
2,2-difluoro-12-[4-(2-methylpropoxy)phenyl]-4-thiophen-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 140807830) has the molecular formula C23H21BF2N2OS and a molecular weight of 422.31 g/mol. Its IUPAC name is 2,2-difluoro-12-[4-(2-methylpropoxy)phenyl]-4-thiophen-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-12-[4-(2-methylpropoxy)phenyl]-4-thiophen-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 140807830 |
| Molecular Formula | C23H21BF2N2OS |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 2,2-difluoro-12-[4-(2-methylpropoxy)phenyl]-4-thiophen-2-yl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | CC(C)COc1ccc(C2=[N+]3C(=Cc4ccc(-c5cccs5)n4[B-]3(F)F)C=C2)cc1 |
| InChI | InChI=1S/C23H21BF2N2OS/c1-16(2)15-29-20-9-5-17(6-10-20)21-11-7-18-14-19-8-12-22(23-4-3-13-30-23)28(19)24(25,26)27(18)21/h3-14,16H,15H2,1-2H3 |
| InChIKey | QFWGMALVFVPBFQ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 17.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|