C19H16ClN8O+ — CID 140809026
4-N-[(1S)-1-(3-chloro-6-phenylimidazo[1,2-b]pyridazin-7-yl)ethyl]-1-hydroxy-5-isocyanopyrimidin-1-ium-4,6-diamine (PubChem CID 140809026) has the molecular formula C19H16ClN8O+ and a molecular weight of 407.85 g/mol. Its IUPAC name is 4-N-[(1S)-1-(3-chloro-6-phenylimidazo[1,2-b]pyridazin-7-yl)ethyl]-1-hydroxy-5-isocyanopyrimidin-1-ium-4,6-diamine.
| Compound Name | 4-N-[(1S)-1-(3-chloro-6-phenylimidazo[1,2-b]pyridazin-7-yl)ethyl]-1-hydroxy-5-isocyanopyrimidin-1-ium-4,6-diamine |
|---|---|
| PubChem CID | 140809026 |
| Molecular Formula | C19H16ClN8O+ |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 4-N-[(1S)-1-(3-chloro-6-phenylimidazo[1,2-b]pyridazin-7-yl)ethyl]-1-hydroxy-5-isocyanopyrimidin-1-ium-4,6-diamine |
| SMILES | [C-]#[N+]c1c(N[C@@H](C)c2cc3ncc(Cl)n3nc2-c2ccccc2)nc[n+](O)c1N |
| InChI | InChI=1S/C19H15ClN8O/c1-11(25-19-17(22-2)18(21)27(29)10-24-19)13-8-15-23-9-14(20)28(15)26-16(13)12-6-4-3-5-7-12/h3-11,29H,1H3,(H2,21,25)/p+1/t11-/m0/s1 |
| InChIKey | VZLUZOTVRZNJAS-NSHDSACASA-O |
| XLogP | 3.28 |
| TPSA | 109.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|