C20H17ClN8O2S — CID 140809051
4-N-[(1S)-1-[3-chloro-6-(2-methylsulfonylphenyl)imidazo[1,2-b]pyridazin-7-yl]ethyl]-5-isocyanopyrimidine-4,6-diamine (PubChem CID 140809051) has the molecular formula C20H17ClN8O2S and a molecular weight of 468.93 g/mol. Its IUPAC name is 4-N-[(1S)-1-[3-chloro-6-(2-methylsulfonylphenyl)imidazo[1,2-b]pyridazin-7-yl]ethyl]-5-isocyanopyrimidine-4,6-diamine.
| Compound Name | 4-N-[(1S)-1-[3-chloro-6-(2-methylsulfonylphenyl)imidazo[1,2-b]pyridazin-7-yl]ethyl]-5-isocyanopyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 140809051 |
| Molecular Formula | C20H17ClN8O2S |
| Molecular Weight | 468.93 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 4-N-[(1S)-1-[3-chloro-6-(2-methylsulfonylphenyl)imidazo[1,2-b]pyridazin-7-yl]ethyl]-5-isocyanopyrimidine-4,6-diamine |
| SMILES | [C-]#[N+]c1c(N)ncnc1N[C@@H](C)c1cc2ncc(Cl)n2nc1-c1ccccc1S(C)(=O)=O |
| InChI | InChI=1S/C20H17ClN8O2S/c1-11(27-20-18(23-2)19(22)25-10-26-20)13-8-16-24-9-15(21)29(16)28-17(13)12-6-4-5-7-14(12)32(3,30)31/h4-11H,1,3H3,(H3,22,25,26,27)/t11-/m0/s1 |
| InChIKey | RRGBPYBNTPTYLJ-NSHDSACASA-N |
| XLogP | 3.55 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.93 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|