C15H16BrN — CID 140809098
2-[4-(4-bromophenyl)cyclopenta-1,3-dien-1-yl]pyrrolidine (PubChem CID 140809098) has the molecular formula C15H16BrN and a molecular weight of 290.20 g/mol. Its IUPAC name is 2-[4-(4-bromophenyl)cyclopenta-1,3-dien-1-yl]pyrrolidine.
| Compound Name | 2-[4-(4-bromophenyl)cyclopenta-1,3-dien-1-yl]pyrrolidine |
|---|---|
| PubChem CID | 140809098 |
| Molecular Formula | C15H16BrN |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 2-[4-(4-bromophenyl)cyclopenta-1,3-dien-1-yl]pyrrolidine |
| SMILES | Brc1ccc(C2=CC=C(C3CCCN3)C2)cc1 |
| InChI | InChI=1S/C15H16BrN/c16-14-7-5-11(6-8-14)12-3-4-13(10-12)15-2-1-9-17-15/h3-8,15,17H,1-2,9-10H2 |
| InChIKey | PUPITEWNLXIUDV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |