C28H20N2O2Zn — CID 140810191
9-methylbenzo[h]quinolin-10-ol;9-methylbenzo[h]quinolin-10-ol;zinc (PubChem CID 140810191) has the molecular formula C28H20N2O2Zn and a molecular weight of 481.87 g/mol. Its IUPAC name is 9-methylbenzo[h]quinolin-10-ol;9-methylbenzo[h]quinolin-10-ol;zinc.
| Compound Name | 9-methylbenzo[h]quinolin-10-ol;9-methylbenzo[h]quinolin-10-ol;zinc |
|---|---|
| PubChem CID | 140810191 |
| Molecular Formula | C28H20N2O2Zn |
| Molecular Weight | 481.87 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | 9-methylbenzo[h]quinolin-10-ol;9-methylbenzo[h]quinolin-10-ol;zinc |
| SMILES | Cc1ccc2ccc3c(c2c1O)N=C=C=C3.Cc1ccc2ccc3cccnc3c2c1O.[Zn] |
| InChI | InChI=1S/C14H11NO.C14H9NO.Zn/c2*1-9-4-5-10-6-7-11-3-2-8-15-13(11)12(10)14(9)16;/h2-8,16H,1H3;3-7,16H,1H3; |
| InChIKey | WTEWQHLZJWJWJW-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.87 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|