C24H25FN3O4S+ — CID 140810583
3-[4-(2,3-dihydro-1H-isoindol-2-ium-5-ylmethylsulfonyl)phenyl]-1-[1-(2-fluorophenyl)ethyl]-1-hydroxyurea (PubChem CID 140810583) has the molecular formula C24H25FN3O4S+ and a molecular weight of 470.55 g/mol. Its IUPAC name is 3-[4-(2,3-dihydro-1H-isoindol-2-ium-5-ylmethylsulfonyl)phenyl]-1-[1-(2-fluorophenyl)ethyl]-1-hydroxyurea.
| Compound Name | 3-[4-(2,3-dihydro-1H-isoindol-2-ium-5-ylmethylsulfonyl)phenyl]-1-[1-(2-fluorophenyl)ethyl]-1-hydroxyurea |
|---|---|
| PubChem CID | 140810583 |
| Molecular Formula | C24H25FN3O4S+ |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 3-[4-(2,3-dihydro-1H-isoindol-2-ium-5-ylmethylsulfonyl)phenyl]-1-[1-(2-fluorophenyl)ethyl]-1-hydroxyurea |
| SMILES | CC(c1ccccc1F)N(O)C(=O)Nc1ccc(S(=O)(=O)Cc2ccc3c(c2)C[NH2+]C3)cc1 |
| InChI | InChI=1S/C24H24FN3O4S/c1-16(22-4-2-3-5-23(22)25)28(30)24(29)27-20-8-10-21(11-9-20)33(31,32)15-17-6-7-18-13-26-14-19(18)12-17/h2-12,16,26,30H,13-15H2,1H3,(H,27,29)/p+1 |
| InChIKey | AEMGLXYAHHKFNQ-UHFFFAOYSA-O |
| XLogP | 3.36 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|