C24H24N4O4S — CID 167264312
3-[4-(2,3-dihydro-1H-isoindol-5-ylmethylsulfonyl)phenyl]-1-nitroso-1-(1-phenylethyl)urea (PubChem CID 167264312) has the molecular formula C24H24N4O4S and a molecular weight of 464.55 g/mol. Its IUPAC name is 3-[4-(2,3-dihydro-1H-isoindol-5-ylmethylsulfonyl)phenyl]-1-nitroso-1-(1-phenylethyl)urea.
| Compound Name | 3-[4-(2,3-dihydro-1H-isoindol-5-ylmethylsulfonyl)phenyl]-1-nitroso-1-(1-phenylethyl)urea |
|---|---|
| PubChem CID | 167264312 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 3-[4-(2,3-dihydro-1H-isoindol-5-ylmethylsulfonyl)phenyl]-1-nitroso-1-(1-phenylethyl)urea |
| SMILES | CC(c1ccccc1)N(N=O)C(=O)Nc1ccc(S(=O)(=O)Cc2ccc3c(c2)CNC3)cc1 |
| InChI | InChI=1S/C24H24N4O4S/c1-17(19-5-3-2-4-6-19)28(27-30)24(29)26-22-9-11-23(12-10-22)33(31,32)16-18-7-8-20-14-25-15-21(20)13-18/h2-13,17,25H,14-16H2,1H3,(H,26,29) |
| InChIKey | GEXWCJUOAUHSPQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|