C21H36N2O2 — CID 140810799
tert-butyl 2-(1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)-2,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 140810799) has the molecular formula C21H36N2O2 and a molecular weight of 348.53 g/mol. Its IUPAC name is tert-butyl 2-(1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)-2,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl 2-(1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)-2,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 140810799 |
| Molecular Formula | C21H36N2O2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | tert-butyl 2-(1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)-2,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CCN(C1CC3CCCC3C1)C2 |
| InChI | InChI=1S/C21H36N2O2/c1-20(2,3)25-19(24)22-10-7-21(8-11-22)9-12-23(15-21)18-13-16-5-4-6-17(16)14-18/h16-18H,4-15H2,1-3H3 |
| InChIKey | WMZRVNSMNALDLG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |