C20H33N3O3 — CID 167439501
tert-butyl 2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl)-2,7-diazaspiro[3.5]nonane-7-carboxylate (PubChem CID 167439501) has the molecular formula C20H33N3O3 and a molecular weight of 363.50 g/mol. Its IUPAC name is tert-butyl 2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl)-2,7-diazaspiro[3.5]nonane-7-carboxylate.
| Compound Name | tert-butyl 2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl)-2,7-diazaspiro[3.5]nonane-7-carboxylate |
|---|---|
| PubChem CID | 167439501 |
| Molecular Formula | C20H33N3O3 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | tert-butyl 2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl)-2,7-diazaspiro[3.5]nonane-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CN(C(=O)N1CC3CCCC3C1)C2 |
| InChI | InChI=1S/C20H33N3O3/c1-19(2,3)26-18(25)21-9-7-20(8-10-21)13-23(14-20)17(24)22-11-15-5-4-6-16(15)12-22/h15-16H,4-14H2,1-3H3 |
| InChIKey | MBOHTCCDURUCDD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |