C6H11N2O5P — CID 140810948
ethoxy-(3-methyl-2,5-dioxoimidazolidin-1-yl)phosphinic acid (PubChem CID 140810948) has the molecular formula C6H11N2O5P and a molecular weight of 222.14 g/mol. Its IUPAC name is ethoxy-(3-methyl-2,5-dioxoimidazolidin-1-yl)phosphinic acid.
| Compound Name | ethoxy-(3-methyl-2,5-dioxoimidazolidin-1-yl)phosphinic acid |
|---|---|
| PubChem CID | 140810948 |
| Molecular Formula | C6H11N2O5P |
| Molecular Weight | 222.14 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | ethoxy-(3-methyl-2,5-dioxoimidazolidin-1-yl)phosphinic acid |
| SMILES | CCOP(=O)(O)N1C(=O)CN(C)C1=O |
| InChI | InChI=1S/C6H11N2O5P/c1-3-13-14(11,12)8-5(9)4-7(2)6(8)10/h3-4H2,1-2H3,(H,11,12) |
| InChIKey | XYRXHCZCCJOGGU-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.14 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|