About bis(methyl(diphenyl)phosphanium);trichlorovanadium
bis(methyl(diphenyl)phosphanium);trichlorovanadium (PubChem CID 140811308) has the molecular formula C26H28Cl3P2V+2
and a molecular weight of 559.76 g/mol. Its IUPAC name is bis(methyl(diphenyl)phosphanium);trichlorovanadium.
Molecular Properties
| Compound Name | bis(methyl(diphenyl)phosphanium);trichlorovanadium |
| PubChem CID | 140811308 |
| Molecular Formula | C26H28Cl3P2V+2 |
| Molecular Weight | 559.76 g/mol |
| Exact Mass | 558.02 |
| IUPAC Name | bis(methyl(diphenyl)phosphanium);trichlorovanadium |
| SMILES | C[PH+](c1ccccc1)c1ccccc1.C[PH+](c1ccccc1)c1ccccc1.Cl[V](Cl)Cl |
| InChI | InChI=1S/2C13H13P.3ClH.V/c2*1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;;;;/h2*2-11H,1H3;3*1H;/q;;;;;+3/p-1 |
| InChIKey | WSSUPJVMWOLNKM-UHFFFAOYSA-M |
| XLogP | 7.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 559.76 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(methyl(diphenyl)phosphanium);trichlorovanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(methyl(diphenyl)phosphanium);trichlorovanadium?
The IUPAC name of bis(methyl(diphenyl)phosphanium);trichlorovanadium (CID 140811308) is bis(methyl(diphenyl)phosphanium);trichlorovanadium.
What is the SMILES notation for bis(methyl(diphenyl)phosphanium);trichlorovanadium?
The canonical SMILES for bis(methyl(diphenyl)phosphanium);trichlorovanadium is C[PH+](c1ccccc1)c1ccccc1.C[PH+](c1ccccc1)c1ccccc1.Cl[V](Cl)Cl.
What is the InChIKey of bis(methyl(diphenyl)phosphanium);trichlorovanadium?
The InChIKey is WSSUPJVMWOLNKM-UHFFFAOYSA-M. The full InChI is InChI=1S/2C13H13P.3ClH.V/c2*1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;;;;/h2*2-11H,1H3;3*1H;/q;;;;;+3/p-1.
What are the key properties of bis(methyl(diphenyl)phosphanium);trichlorovanadium?
bis(methyl(diphenyl)phosphanium);trichlorovanadium has a molecular weight of 559.76 g/mol, XLogP of 7.03, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(methyl(diphenyl)phosphanium);trichlorovanadium is sourced from PubChem (CID 140811308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).