C15H22O3 — CID 14081209
(2aS,3R,6S,7R,7bS)-7-hydroxy-6-(hydroxymethyl)-3,6,7b-trimethyl-1,2,2a,3,5,7-hexahydrocyclobuta[e]inden-4-one (PubChem CID 14081209) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (2aS,3R,6S,7R,7bS)-7-hydroxy-6-(hydroxymethyl)-3,6,7b-trimethyl-1,2,2a,3,5,7-hexahydrocyclobuta[e]inden-4-one.
| Compound Name | (2aS,3R,6S,7R,7bS)-7-hydroxy-6-(hydroxymethyl)-3,6,7b-trimethyl-1,2,2a,3,5,7-hexahydrocyclobuta[e]inden-4-one |
|---|---|
| PubChem CID | 14081209 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (2aS,3R,6S,7R,7bS)-7-hydroxy-6-(hydroxymethyl)-3,6,7b-trimethyl-1,2,2a,3,5,7-hexahydrocyclobuta[e]inden-4-one |
| SMILES | C[C@H]1C(=O)C2=C([C@@H](O)[C@](C)(CO)C2)[C@@]2(C)CC[C@@H]12 |
| InChI | InChI=1S/C15H22O3/c1-8-10-4-5-15(10,3)11-9(12(8)17)6-14(2,7-16)13(11)18/h8,10,13,16,18H,4-7H2,1-3H3/t8-,10+,13-,14+,15+/m1/s1 |
| InChIKey | NZWXMRFXFZBUBR-LIWPIPGMSA-N |
| XLogP | 1.68 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |