C20H32O2 — CID 163028681
7-ethenyl-1-(hydroxymethyl)-1,4a,7-trimethyl-2,4,4b,5,6,8,8a,9,10,10a-decahydrophenanthren-3-one (PubChem CID 163028681) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is 7-ethenyl-1-(hydroxymethyl)-1,4a,7-trimethyl-2,4,4b,5,6,8,8a,9,10,10a-decahydrophenanthren-3-one.
| Compound Name | 7-ethenyl-1-(hydroxymethyl)-1,4a,7-trimethyl-2,4,4b,5,6,8,8a,9,10,10a-decahydrophenanthren-3-one |
|---|---|
| PubChem CID | 163028681 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 7-ethenyl-1-(hydroxymethyl)-1,4a,7-trimethyl-2,4,4b,5,6,8,8a,9,10,10a-decahydrophenanthren-3-one |
| SMILES | C=CC1(C)CCC2C(CCC3C(C)(CO)CC(=O)CC23C)C1 |
| InChI | InChI=1S/C20H32O2/c1-5-18(2)9-8-16-14(10-18)6-7-17-19(3,13-21)11-15(22)12-20(16,17)4/h5,14,16-17,21H,1,6-13H2,2-4H3 |
| InChIKey | LETFYNLWBOBTCD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|