C20H32O4 — CID 153490928
7-(carboxymethyl)-1,4a,7-trimethyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthrene-1-carboxylic acid (PubChem CID 153490928) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is 7-(carboxymethyl)-1,4a,7-trimethyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthrene-1-carboxylic acid.
| Compound Name | 7-(carboxymethyl)-1,4a,7-trimethyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 153490928 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 7-(carboxymethyl)-1,4a,7-trimethyl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthrene-1-carboxylic acid |
| SMILES | CC1(CC(=O)O)CCC2C(CCC3C(C)(C(=O)O)CCCC23C)C1 |
| InChI | InChI=1S/C20H32O4/c1-18(12-16(21)22)10-7-14-13(11-18)5-6-15-19(14,2)8-4-9-20(15,3)17(23)24/h13-15H,4-12H2,1-3H3,(H,21,22)(H,23,24) |
| InChIKey | NLXCRTHOWWHDDM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |