C25H44O2 — CID 23599986
tert-butyl 1,4a,7-trimethyl-7-propan-2-yl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthrene-1-carboxylate (PubChem CID 23599986) has the molecular formula C25H44O2 and a molecular weight of 376.63 g/mol. Its IUPAC name is tert-butyl 1,4a,7-trimethyl-7-propan-2-yl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthrene-1-carboxylate.
| Compound Name | tert-butyl 1,4a,7-trimethyl-7-propan-2-yl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 23599986 |
| Molecular Formula | C25H44O2 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 376.33 |
| IUPAC Name | tert-butyl 1,4a,7-trimethyl-7-propan-2-yl-3,4,4b,5,6,8,8a,9,10,10a-decahydro-2H-phenanthrene-1-carboxylate |
| SMILES | CC(C)C1(C)CCC2C(CCC3C(C)(C(=O)OC(C)(C)C)CCCC23C)C1 |
| InChI | InChI=1S/C25H44O2/c1-17(2)23(6)15-12-19-18(16-23)10-11-20-24(19,7)13-9-14-25(20,8)21(26)27-22(3,4)5/h17-20H,9-16H2,1-8H3 |
| InChIKey | VRHJVMYBWRZVDZ-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |