C23H43NO3 — CID 155885353
(2R,4aS,4bR,10aS)-2-ethyl-2,4b,8,8-tetramethyl-3,4,4a,5,6,7,8a,9,10,10a-decahydro-1H-phenanthrene;(2S)-2-amino-3-hydroxypropanoic acid (PubChem CID 155885353) has the molecular formula C23H43NO3 and a molecular weight of 381.60 g/mol. Its IUPAC name is (2R,4aS,4bR,10aS)-2-ethyl-2,4b,8,8-tetramethyl-3,4,4a,5,6,7,8a,9,10,10a-decahydro-1H-phenanthrene;(2S)-2-amino-3-hydroxypropanoic acid.
| Compound Name | (2R,4aS,4bR,10aS)-2-ethyl-2,4b,8,8-tetramethyl-3,4,4a,5,6,7,8a,9,10,10a-decahydro-1H-phenanthrene;(2S)-2-amino-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 155885353 |
| Molecular Formula | C23H43NO3 |
| Molecular Weight | 381.60 g/mol |
| Exact Mass | 381.32 |
| IUPAC Name | (2R,4aS,4bR,10aS)-2-ethyl-2,4b,8,8-tetramethyl-3,4,4a,5,6,7,8a,9,10,10a-decahydro-1H-phenanthrene;(2S)-2-amino-3-hydroxypropanoic acid |
| SMILES | CC[C@]1(C)CC[C@H]2[C@@H](CCC3C(C)(C)CCC[C@@]32C)C1.N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C20H36.C3H7NO3/c1-6-19(4)13-10-16-15(14-19)8-9-17-18(2,3)11-7-12-20(16,17)5;4-2(1-5)3(6)7/h15-17H,6-14H2,1-5H3;2,5H,1,4H2,(H,6,7)/t15-,16-,17?,19+,20+;2-/m00/s1 |
| InChIKey | UBJFAMSADMSZAE-NGZOUEAFSA-N |
| XLogP | 4.84 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.60 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |