C23H39NO2 — CID 163171196
2-[(4bS,6aR,10aS,10bR)-4b,7,7,10a-tetramethyl-2,3,4,4a,5,6,6a,8,9,10,10b,11,12,12a-tetradecahydro-1H-naphtho[2,1-f]isoquinolin-2-ium-2-yl]acetate (PubChem CID 163171196) has the molecular formula C23H39NO2 and a molecular weight of 361.57 g/mol. Its IUPAC name is 2-[(4bS,6aR,10aS,10bR)-4b,7,7,10a-tetramethyl-2,3,4,4a,5,6,6a,8,9,10,10b,11,12,12a-tetradecahydro-1H-naphtho[2,1-f]isoquinolin-2-ium-2-yl]acetate.
| Compound Name | 2-[(4bS,6aR,10aS,10bR)-4b,7,7,10a-tetramethyl-2,3,4,4a,5,6,6a,8,9,10,10b,11,12,12a-tetradecahydro-1H-naphtho[2,1-f]isoquinolin-2-ium-2-yl]acetate |
|---|---|
| PubChem CID | 163171196 |
| Molecular Formula | C23H39NO2 |
| Molecular Weight | 361.57 g/mol |
| Exact Mass | 361.30 |
| IUPAC Name | 2-[(4bS,6aR,10aS,10bR)-4b,7,7,10a-tetramethyl-2,3,4,4a,5,6,6a,8,9,10,10b,11,12,12a-tetradecahydro-1H-naphtho[2,1-f]isoquinolin-2-ium-2-yl]acetate |
| SMILES | CC1(C)CCC[C@@]2(C)[C@@H]1CC[C@@]1(C)C3CC[NH+](CC(=O)[O-])CC3CC[C@@H]21 |
| InChI | InChI=1S/C23H39NO2/c1-21(2)10-5-11-23(4)18(21)8-12-22(3)17-9-13-24(15-20(25)26)14-16(17)6-7-19(22)23/h16-19H,5-15H2,1-4H3,(H,25,26)/t16?,17?,18-,19-,22+,23+/m1/s1 |
| InChIKey | HOCXAFGZBWDREV-QQJLCBTMSA-N |
| XLogP | 2.30 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.57 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |