C32H50O7S2 — CID 140812901
4,5-didecyl-3-phenoxybenzene-1,2-disulfonic acid (PubChem CID 140812901) has the molecular formula C32H50O7S2 and a molecular weight of 610.88 g/mol. Its IUPAC name is 4,5-didecyl-3-phenoxybenzene-1,2-disulfonic acid.
| Compound Name | 4,5-didecyl-3-phenoxybenzene-1,2-disulfonic acid |
|---|---|
| PubChem CID | 140812901 |
| Molecular Formula | C32H50O7S2 |
| Molecular Weight | 610.88 g/mol |
| Exact Mass | 610.30 |
| IUPAC Name | 4,5-didecyl-3-phenoxybenzene-1,2-disulfonic acid |
| SMILES | CCCCCCCCCCc1cc(S(=O)(=O)O)c(S(=O)(=O)O)c(Oc2ccccc2)c1CCCCCCCCCC |
| InChI | InChI=1S/C32H50O7S2/c1-3-5-7-9-11-13-15-18-22-27-26-30(40(33,34)35)32(41(36,37)38)31(39-28-23-19-17-20-24-28)29(27)25-21-16-14-12-10-8-6-4-2/h17,19-20,23-24,26H,3-16,18,21-22,25H2,1-2H3,(H,33,34,35)(H,36,37,38) |
| InChIKey | BCQPZHXDSFBTDB-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.88 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|