C26H40O3S — CID 101318988
3,4-dioctylnaphthalene-1-sulfonic acid (PubChem CID 101318988) has the molecular formula C26H40O3S and a molecular weight of 432.67 g/mol. Its IUPAC name is 3,4-dioctylnaphthalene-1-sulfonic acid.
| Compound Name | 3,4-dioctylnaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 101318988 |
| Molecular Formula | C26H40O3S |
| Molecular Weight | 432.67 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | 3,4-dioctylnaphthalene-1-sulfonic acid |
| SMILES | CCCCCCCCc1cc(S(=O)(=O)O)c2ccccc2c1CCCCCCCC |
| InChI | InChI=1S/C26H40O3S/c1-3-5-7-9-11-13-17-22-21-26(30(27,28)29)25-20-16-15-19-24(25)23(22)18-14-12-10-8-6-4-2/h15-16,19-21H,3-14,17-18H2,1-2H3,(H,27,28,29) |
| InChIKey | WMGBOENSTCJIPH-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.67 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|