C26H21F6N5O3 — CID 140815732
[2,6-dimethyl-3-(4-pyrrolidin-1-ylpyrimidin-2-yl)-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-5-yl] 2,2,2-trifluoroacetate (PubChem CID 140815732) has the molecular formula C26H21F6N5O3 and a molecular weight of 565.47 g/mol. Its IUPAC name is [2,6-dimethyl-3-(4-pyrrolidin-1-ylpyrimidin-2-yl)-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-5-yl] 2,2,2-trifluoroacetate.
| Compound Name | [2,6-dimethyl-3-(4-pyrrolidin-1-ylpyrimidin-2-yl)-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-5-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140815732 |
| Molecular Formula | C26H21F6N5O3 |
| Molecular Weight | 565.47 g/mol |
| Exact Mass | 565.15 |
| IUPAC Name | [2,6-dimethyl-3-(4-pyrrolidin-1-ylpyrimidin-2-yl)-8-[(2,3,6-trifluorophenyl)methoxy]imidazo[1,2-a]pyridin-5-yl] 2,2,2-trifluoroacetate |
| SMILES | Cc1cc(OCc2c(F)ccc(F)c2F)c2nc(C)c(-c3nccc(N4CCCC4)n3)n2c1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C26H21F6N5O3/c1-13-11-18(39-12-15-16(27)5-6-17(28)20(15)29)23-34-14(2)21(37(23)24(13)40-25(38)26(30,31)32)22-33-8-7-19(35-22)36-9-3-4-10-36/h5-8,11H,3-4,9-10,12H2,1-2H3 |
| InChIKey | URFUYIKHCVEUSZ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 81.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.47 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|