C21H24FN5O — CID 140816424
N-[1-(2-fluoroethyl)-6-(1-methylpyrazol-4-yl)isoquinolin-3-yl]piperidine-4-carboxamide (PubChem CID 140816424) has the molecular formula C21H24FN5O and a molecular weight of 381.46 g/mol. Its IUPAC name is N-[1-(2-fluoroethyl)-6-(1-methylpyrazol-4-yl)isoquinolin-3-yl]piperidine-4-carboxamide.
| Compound Name | N-[1-(2-fluoroethyl)-6-(1-methylpyrazol-4-yl)isoquinolin-3-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 140816424 |
| Molecular Formula | C21H24FN5O |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | N-[1-(2-fluoroethyl)-6-(1-methylpyrazol-4-yl)isoquinolin-3-yl]piperidine-4-carboxamide |
| SMILES | Cn1cc(-c2ccc3c(CCF)nc(NC(=O)C4CCNCC4)cc3c2)cn1 |
| InChI | InChI=1S/C21H24FN5O/c1-27-13-17(12-24-27)15-2-3-18-16(10-15)11-20(25-19(18)4-7-22)26-21(28)14-5-8-23-9-6-14/h2-3,10-14,23H,4-9H2,1H3,(H,25,26,28) |
| InChIKey | MKLVUUBFDWVEKK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |