C18H30 — CID 140816676
(2,6-dimethyl-4-propan-2-ylheptan-3-yl)benzene (PubChem CID 140816676) has the molecular formula C18H30 and a molecular weight of 246.44 g/mol. Its IUPAC name is (2,6-dimethyl-4-propan-2-ylheptan-3-yl)benzene.
| Compound Name | (2,6-dimethyl-4-propan-2-ylheptan-3-yl)benzene |
|---|---|
| PubChem CID | 140816676 |
| Molecular Formula | C18H30 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | (2,6-dimethyl-4-propan-2-ylheptan-3-yl)benzene |
| SMILES | CC(C)CC(C(C)C)C(c1ccccc1)C(C)C |
| InChI | InChI=1S/C18H30/c1-13(2)12-17(14(3)4)18(15(5)6)16-10-8-7-9-11-16/h7-11,13-15,17-18H,12H2,1-6H3 |
| InChIKey | MTAUVRGXIFIAEO-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |