About 4-(5-methyl-3,4-dihydro-2H-pyrrol-4-yl)butan-2-one
4-(5-methyl-3,4-dihydro-2H-pyrrol-4-yl)butan-2-one (PubChem CID 14081806) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is 4-(5-methyl-3,4-dihydro-2H-pyrrol-4-yl)butan-2-one.
Analyze 4-(5-methyl-3,4-dihydro-2H-pyrrol-4-yl)butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-methyl-3,4-dihydro-2H-pyrrol-4-yl)butan-2-one?
The IUPAC name of 4-(5-methyl-3,4-dihydro-2H-pyrrol-4-yl)butan-2-one (CID 14081806) is 4-(5-methyl-3,4-dihydro-2H-pyrrol-4-yl)butan-2-one.
What is the SMILES notation for 4-(5-methyl-3,4-dihydro-2H-pyrrol-4-yl)butan-2-one?
The canonical SMILES for 4-(5-methyl-3,4-dihydro-2H-pyrrol-4-yl)butan-2-one is CC(=O)CCC1CCN=C1C.
What is the InChIKey of 4-(5-methyl-3,4-dihydro-2H-pyrrol-4-yl)butan-2-one?
The InChIKey is SFSDHXAHELNSMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-7(11)3-4-9-5-6-10-8(9)2/h9H,3-6H2,1-2H3.
What are the key properties of 4-(5-methyl-3,4-dihydro-2H-pyrrol-4-yl)butan-2-one?
4-(5-methyl-3,4-dihydro-2H-pyrrol-4-yl)butan-2-one has a molecular weight of 153.22 g/mol, XLogP of 1.84, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-methyl-3,4-dihydro-2H-pyrrol-4-yl)butan-2-one is sourced from PubChem (CID 14081806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).