C15H16IN3 — CID 140819726
4-(2,2-dimethylpropylamino)-2-iodoquinoline-3-carbonitrile (PubChem CID 140819726) has the molecular formula C15H16IN3 and a molecular weight of 365.22 g/mol. Its IUPAC name is 4-(2,2-dimethylpropylamino)-2-iodoquinoline-3-carbonitrile.
| Compound Name | 4-(2,2-dimethylpropylamino)-2-iodoquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 140819726 |
| Molecular Formula | C15H16IN3 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 4-(2,2-dimethylpropylamino)-2-iodoquinoline-3-carbonitrile |
| SMILES | CC(C)(C)CNc1c(C#N)c(I)nc2ccccc12 |
| InChI | InChI=1S/C15H16IN3/c1-15(2,3)9-18-13-10-6-4-5-7-12(10)19-14(16)11(13)8-17/h4-7H,9H2,1-3H3,(H,18,19) |
| InChIKey | VQHSSZMXPZMUTG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|