C16H19N3O — CID 140819707
4-(2,2-dimethylpropylamino)-2-methoxyquinoline-3-carbonitrile (PubChem CID 140819707) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is 4-(2,2-dimethylpropylamino)-2-methoxyquinoline-3-carbonitrile.
| Compound Name | 4-(2,2-dimethylpropylamino)-2-methoxyquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 140819707 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 4-(2,2-dimethylpropylamino)-2-methoxyquinoline-3-carbonitrile |
| SMILES | COc1nc2ccccc2c(NCC(C)(C)C)c1C#N |
| InChI | InChI=1S/C16H19N3O/c1-16(2,3)10-18-14-11-7-5-6-8-13(11)19-15(20-4)12(14)9-17/h5-8H,10H2,1-4H3,(H,18,19) |
| InChIKey | PHOKMWSIAMBRMK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |