C40H30N2OSi — CID 140820703
7-(10,10-diphenylbenzo[b][1,4]benzazasilin-5-yl)-4-methyl-2-phenylisoquinolin-1-one (PubChem CID 140820703) has the molecular formula C40H30N2OSi and a molecular weight of 582.78 g/mol. Its IUPAC name is 7-(10,10-diphenylbenzo[b][1,4]benzazasilin-5-yl)-4-methyl-2-phenylisoquinolin-1-one.
| Compound Name | 7-(10,10-diphenylbenzo[b][1,4]benzazasilin-5-yl)-4-methyl-2-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 140820703 |
| Molecular Formula | C40H30N2OSi |
| Molecular Weight | 582.78 g/mol |
| Exact Mass | 582.21 |
| IUPAC Name | 7-(10,10-diphenylbenzo[b][1,4]benzazasilin-5-yl)-4-methyl-2-phenylisoquinolin-1-one |
| SMILES | Cc1cn(-c2ccccc2)c(=O)c2cc(N3c4ccccc4[Si](c4ccccc4)(c4ccccc4)c4ccccc43)ccc12 |
| InChI | InChI=1S/C40H30N2OSi/c1-29-28-41(30-15-5-2-6-16-30)40(43)35-27-31(25-26-34(29)35)42-36-21-11-13-23-38(36)44(32-17-7-3-8-18-32,33-19-9-4-10-20-33)39-24-14-12-22-37(39)42/h2-28H,1H3 |
| InChIKey | ZGMKTVJODPKCOP-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.78 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|