C58H48N2Si2 — CID 140856458
5-[3-[10,10-bis(4-methylphenyl)benzo[b][1,4]benzazasilin-5-yl]phenyl]-2,8-dimethyl-10,10-diphenylbenzo[b][1,4]benzazasiline (PubChem CID 140856458) has the molecular formula C58H48N2Si2 and a molecular weight of 829.21 g/mol. Its IUPAC name is 5-[3-[10,10-bis(4-methylphenyl)benzo[b][1,4]benzazasilin-5-yl]phenyl]-2,8-dimethyl-10,10-diphenylbenzo[b][1,4]benzazasiline.
| Compound Name | 5-[3-[10,10-bis(4-methylphenyl)benzo[b][1,4]benzazasilin-5-yl]phenyl]-2,8-dimethyl-10,10-diphenylbenzo[b][1,4]benzazasiline |
|---|---|
| PubChem CID | 140856458 |
| Molecular Formula | C58H48N2Si2 |
| Molecular Weight | 829.21 g/mol |
| Exact Mass | 828.34 |
| IUPAC Name | 5-[3-[10,10-bis(4-methylphenyl)benzo[b][1,4]benzazasilin-5-yl]phenyl]-2,8-dimethyl-10,10-diphenylbenzo[b][1,4]benzazasiline |
| SMILES | Cc1ccc([Si]2(c3ccc(C)cc3)c3ccccc3N(c3cccc(N4c5ccc(C)cc5[Si](c5ccccc5)(c5ccccc5)c5cc(C)ccc54)c3)c3ccccc32)cc1 |
| InChI | InChI=1S/C58H48N2Si2/c1-41-26-32-49(33-27-41)61(50-34-28-42(2)29-35-50)55-24-13-11-22-51(55)59(52-23-12-14-25-56(52)61)45-16-15-17-46(40-45)60-53-36-30-43(3)38-57(53)62(47-18-7-5-8-19-47,48-20-9-6-10-21-48)58-39-44(4)31-37-54(58)60/h5-40H,1-4H3 |
| InChIKey | NQHVONOTPRNDGH-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.21 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|