C27H37NSSi — CID 140821270
N-[(1,2-dimethyl-3H-indeno[5,4-b][1]benzothiol-3-yl)-dimethylsilyl]-2,4,4-trimethylpentan-2-amine (PubChem CID 140821270) has the molecular formula C27H37NSSi and a molecular weight of 435.75 g/mol. Its IUPAC name is N-[(1,2-dimethyl-3H-indeno[5,4-b][1]benzothiol-3-yl)-dimethylsilyl]-2,4,4-trimethylpentan-2-amine.
| Compound Name | N-[(1,2-dimethyl-3H-indeno[5,4-b][1]benzothiol-3-yl)-dimethylsilyl]-2,4,4-trimethylpentan-2-amine |
|---|---|
| PubChem CID | 140821270 |
| Molecular Formula | C27H37NSSi |
| Molecular Weight | 435.75 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | N-[(1,2-dimethyl-3H-indeno[5,4-b][1]benzothiol-3-yl)-dimethylsilyl]-2,4,4-trimethylpentan-2-amine |
| SMILES | CC1=C(C)C([Si](C)(C)NC(C)(C)CC(C)(C)C)c2ccc3sc4ccccc4c3c21 |
| InChI | InChI=1S/C27H37NSSi/c1-17-18(2)25(30(8,9)28-27(6,7)16-26(3,4)5)20-14-15-22-24(23(17)20)19-12-10-11-13-21(19)29-22/h10-15,25,28H,16H2,1-9H3 |
| InChIKey | RHDIYRFOMGOLGB-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.75 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|