C15H17ClSSi — CID 142744406
chloro-(1,2-dimethyl-3H-cyclopenta[b][1]benzothiol-3-yl)-dimethylsilane (PubChem CID 142744406) has the molecular formula C15H17ClSSi and a molecular weight of 292.91 g/mol. Its IUPAC name is chloro-(1,2-dimethyl-3H-cyclopenta[b][1]benzothiol-3-yl)-dimethylsilane.
| Compound Name | chloro-(1,2-dimethyl-3H-cyclopenta[b][1]benzothiol-3-yl)-dimethylsilane |
|---|---|
| PubChem CID | 142744406 |
| Molecular Formula | C15H17ClSSi |
| Molecular Weight | 292.91 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | chloro-(1,2-dimethyl-3H-cyclopenta[b][1]benzothiol-3-yl)-dimethylsilane |
| SMILES | CC1=C(C)C([Si](C)(C)Cl)c2sc3ccccc3c21 |
| InChI | InChI=1S/C15H17ClSSi/c1-9-10(2)15(18(3,4)16)14-13(9)11-7-5-6-8-12(11)17-14/h5-8,15H,1-4H3 |
| InChIKey | HSONOXYFJRIVOJ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.91 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|