C15H38N2O6Si2 — CID 140821445
N-butyl-N-propyl-1,1-bis(trimethoxysilyl)ethane-1,2-diamine (PubChem CID 140821445) has the molecular formula C15H38N2O6Si2 and a molecular weight of 398.65 g/mol. Its IUPAC name is N-butyl-N-propyl-1,1-bis(trimethoxysilyl)ethane-1,2-diamine.
| Compound Name | N-butyl-N-propyl-1,1-bis(trimethoxysilyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 140821445 |
| Molecular Formula | C15H38N2O6Si2 |
| Molecular Weight | 398.65 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | N-butyl-N-propyl-1,1-bis(trimethoxysilyl)ethane-1,2-diamine |
| SMILES | CCCCN(CCC)C(CN)([Si](OC)(OC)OC)[Si](OC)(OC)OC |
| InChI | InChI=1S/C15H38N2O6Si2/c1-9-11-13-17(12-10-2)15(14-16,24(18-3,19-4)20-5)25(21-6,22-7)23-8/h9-14,16H2,1-8H3 |
| InChIKey | CBMHHCNDXPVVKT-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.65 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|