C9H13Cl2N3O3 — CID 140823752
4-amino-3,6-dichloropyridine-2-carboxylate;2-hydroxypropylazanium (PubChem CID 140823752) has the molecular formula C9H13Cl2N3O3 and a molecular weight of 282.13 g/mol. Its IUPAC name is 4-amino-3,6-dichloropyridine-2-carboxylate;2-hydroxypropylazanium.
| Compound Name | 4-amino-3,6-dichloropyridine-2-carboxylate;2-hydroxypropylazanium |
|---|---|
| PubChem CID | 140823752 |
| Molecular Formula | C9H13Cl2N3O3 |
| Molecular Weight | 282.13 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 4-amino-3,6-dichloropyridine-2-carboxylate;2-hydroxypropylazanium |
| SMILES | CC(O)C[NH3+].Nc1cc(Cl)nc(C(=O)[O-])c1Cl |
| InChI | InChI=1S/C6H4Cl2N2O2.C3H9NO/c7-3-1-2(9)4(8)5(10-3)6(11)12;1-3(5)2-4/h1H,(H2,9,10)(H,11,12);3,5H,2,4H2,1H3 |
| InChIKey | GQWJKECIEOFLPX-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 126.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.13 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|