C9H10Cl2N2O2 — CID 142076144
propan-2-yl 4-amino-3,6-dichloropyridine-2-carboxylate (PubChem CID 142076144) has the molecular formula C9H10Cl2N2O2 and a molecular weight of 249.10 g/mol. Its IUPAC name is propan-2-yl 4-amino-3,6-dichloropyridine-2-carboxylate.
| Compound Name | propan-2-yl 4-amino-3,6-dichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 142076144 |
| Molecular Formula | C9H10Cl2N2O2 |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | propan-2-yl 4-amino-3,6-dichloropyridine-2-carboxylate |
| SMILES | CC(C)OC(=O)c1nc(Cl)cc(N)c1Cl |
| InChI | InChI=1S/C9H10Cl2N2O2/c1-4(2)15-9(14)8-7(11)5(12)3-6(10)13-8/h3-4H,1-2H3,(H2,12,13) |
| InChIKey | WBRUCXXOKFECQJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|