C10H10ClF2NO2 — CID 158871285
propan-2-yl 3-chloro-5,6-difluoro-4-methylpyridine-2-carboxylate (PubChem CID 158871285) has the molecular formula C10H10ClF2NO2 and a molecular weight of 249.64 g/mol. Its IUPAC name is propan-2-yl 3-chloro-5,6-difluoro-4-methylpyridine-2-carboxylate.
| Compound Name | propan-2-yl 3-chloro-5,6-difluoro-4-methylpyridine-2-carboxylate |
|---|---|
| PubChem CID | 158871285 |
| Molecular Formula | C10H10ClF2NO2 |
| Molecular Weight | 249.64 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | propan-2-yl 3-chloro-5,6-difluoro-4-methylpyridine-2-carboxylate |
| SMILES | Cc1c(F)c(F)nc(C(=O)OC(C)C)c1Cl |
| InChI | InChI=1S/C10H10ClF2NO2/c1-4(2)16-10(15)8-6(11)5(3)7(12)9(13)14-8/h4H,1-3H3 |
| InChIKey | NKKPBMIAZUDOPO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.64 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|