C13H4Cl2F5NO2 — CID 91747684
(2,3,4,5,6-pentafluorophenyl)methyl 3,6-dichloropyridine-2-carboxylate (PubChem CID 91747684) has the molecular formula C13H4Cl2F5NO2 and a molecular weight of 372.08 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methyl 3,6-dichloropyridine-2-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methyl 3,6-dichloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 91747684 |
| Molecular Formula | C13H4Cl2F5NO2 |
| Molecular Weight | 372.08 g/mol |
| Exact Mass | 370.95 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methyl 3,6-dichloropyridine-2-carboxylate |
| SMILES | O=C(OCc1c(F)c(F)c(F)c(F)c1F)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H4Cl2F5NO2/c14-5-1-2-6(15)21-12(5)13(22)23-3-4-7(16)9(18)11(20)10(19)8(4)17/h1-2H,3H2 |
| InChIKey | BVXQHQBVQUMRFC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.08 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|