C22H24F3N7O4 — CID 140824613
8-N-[4-(2-hydroxyethylcarbamoyl)-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 140824613) has the molecular formula C22H24F3N7O4 and a molecular weight of 507.47 g/mol. Its IUPAC name is 8-N-[4-(2-hydroxyethylcarbamoyl)-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | 8-N-[4-(2-hydroxyethylcarbamoyl)-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 140824613 |
| Molecular Formula | C22H24F3N7O4 |
| Molecular Weight | 507.47 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 8-N-[4-(2-hydroxyethylcarbamoyl)-2-pyridinyl]-5-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc2c(n1)N(C(=O)Nc1cc(C(=O)NCCO)ccn1)C1CCN2C1)C(F)(F)F |
| InChI | InChI=1S/C22H24F3N7O4/c1-12(22(23,24)25)28-20(35)15-2-3-16-18(29-15)32(14-5-8-31(16)11-14)21(36)30-17-10-13(4-6-26-17)19(34)27-7-9-33/h2-4,6,10,12,14,33H,5,7-9,11H2,1H3,(H,27,34)(H,28,35)(H,26,30,36)/t12-,14?/m1/s1 |
| InChIKey | YXZWIZYSTIGPFC-PUODRLBUSA-N |
| XLogP | 1.51 |
| TPSA | 139.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.47 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |