C21H22F3N7O4 — CID 140824798
8-N-[4-(2-hydroxyethylcarbamoyl)-2-pyridinyl]-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 140824798) has the molecular formula C21H22F3N7O4 and a molecular weight of 493.45 g/mol. Its IUPAC name is 8-N-[4-(2-hydroxyethylcarbamoyl)-2-pyridinyl]-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | 8-N-[4-(2-hydroxyethylcarbamoyl)-2-pyridinyl]-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 140824798 |
| Molecular Formula | C21H22F3N7O4 |
| Molecular Weight | 493.45 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | 8-N-[4-(2-hydroxyethylcarbamoyl)-2-pyridinyl]-5-N-(2,2,2-trifluoroethyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | O=C(NCCO)c1ccnc(NC(=O)N2c3nc(C(=O)NCC(F)(F)F)ccc3N3CCC2C3)c1 |
| InChI | InChI=1S/C21H22F3N7O4/c22-21(23,24)11-27-19(34)14-1-2-15-17(28-14)31(13-4-7-30(15)10-13)20(35)29-16-9-12(3-5-25-16)18(33)26-6-8-32/h1-3,5,9,13,32H,4,6-8,10-11H2,(H,26,33)(H,27,34)(H,25,29,35) |
| InChIKey | RBKCVILIHOEEGY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 139.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.45 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |