C19H19N5O — CID 140824867
5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-N-(5-isocyano-2-methylphenyl)-2-N-methylpyridine-2,3-diamine (PubChem CID 140824867) has the molecular formula C19H19N5O and a molecular weight of 333.40 g/mol. Its IUPAC name is 5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-N-(5-isocyano-2-methylphenyl)-2-N-methylpyridine-2,3-diamine.
| Compound Name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-N-(5-isocyano-2-methylphenyl)-2-N-methylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 140824867 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-N-(5-isocyano-2-methylphenyl)-2-N-methylpyridine-2,3-diamine |
| SMILES | [C-]#[N+]c1ccc(C)c(Nc2cc(-c3c(C)noc3C)cnc2NC)c1 |
| InChI | InChI=1S/C19H19N5O/c1-11-6-7-15(20-4)9-16(11)23-17-8-14(10-22-19(17)21-5)18-12(2)24-25-13(18)3/h6-10,23H,1-3,5H3,(H,21,22) |
| InChIKey | LKSNCGLNRQHUPB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 67.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|