C23H24N4 — CID 140794388
2-N-(4-tert-butylphenyl)-5-isocyano-3-N-(2-methylphenyl)pyridine-2,3-diamine (PubChem CID 140794388) has the molecular formula C23H24N4 and a molecular weight of 356.47 g/mol. Its IUPAC name is 2-N-(4-tert-butylphenyl)-5-isocyano-3-N-(2-methylphenyl)pyridine-2,3-diamine.
| Compound Name | 2-N-(4-tert-butylphenyl)-5-isocyano-3-N-(2-methylphenyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 140794388 |
| Molecular Formula | C23H24N4 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 2-N-(4-tert-butylphenyl)-5-isocyano-3-N-(2-methylphenyl)pyridine-2,3-diamine |
| SMILES | [C-]#[N+]c1cnc(Nc2ccc(C(C)(C)C)cc2)c(Nc2ccccc2C)c1 |
| InChI | InChI=1S/C23H24N4/c1-16-8-6-7-9-20(16)27-21-14-19(24-5)15-25-22(21)26-18-12-10-17(11-13-18)23(2,3)4/h6-15,27H,1-4H3,(H,25,26) |
| InChIKey | YEIRALYHLCPSFD-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 41.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|