C24H34N4O2Si — CID 140825038
2-[2-(benzylamino)benzimidazol-1-yl]-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]acetamide (PubChem CID 140825038) has the molecular formula C24H34N4O2Si and a molecular weight of 438.65 g/mol. Its IUPAC name is 2-[2-(benzylamino)benzimidazol-1-yl]-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]acetamide.
| Compound Name | 2-[2-(benzylamino)benzimidazol-1-yl]-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]acetamide |
|---|---|
| PubChem CID | 140825038 |
| Molecular Formula | C24H34N4O2Si |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 2-[2-(benzylamino)benzimidazol-1-yl]-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]acetamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCNC(=O)Cn1c(NCc2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C24H34N4O2Si/c1-24(2,3)31(4,5)30-16-15-25-22(29)18-28-21-14-10-9-13-20(21)27-23(28)26-17-19-11-7-6-8-12-19/h6-14H,15-18H2,1-5H3,(H,25,29)(H,26,27) |
| InChIKey | KGSNGZMDIPGIRW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|